Product Information:
| Cat. No.: EX-A15715 | Purity: |
![]() | |
| Chemical structure of 9H-Purine, 6-chloro-8-(2-chlorophenyl)-9-(4-chlorophenyl)- |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 686344-50-3 |
|---|---|
| Formula | C17H9Cl3N4 |
| Mol Weight | 375.639 |
| CoA | CoA of 9H-Purine, 6-chloro-8-(2-chlorophenyl)-9-(4-chlorophenyl)- |
| Smiles: | ClC1=CC=C(C=C1)N2C=3N=CN=C(Cl)C3N=C2C=4C=CC=CC4Cl |
|---|
KEYWORDS: buy 9H-Purine, 6-chloro-8-(2-chlorophenyl)-9-(4-chlorophenyl)- | 9H-Purine, 6-chloro-8-(2-chlorophenyl)-9-(4-chlorophenyl)- supplier | purchase | cost | manufacturer | order | distributor | buy 686344-50-3 | 686344-50-3 supplier


Inhibitor Specialist
